CAS 460736-49-6 appears in our catalog under these names: 2-[(4-Fluorobenzyl)thio]nicotinic acid, 95%, 2-{((4-fluorophenyl)methyl)sulfanyl}pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid (CAS 460736-49-6) is a chemical compound with the molecular formula C13H10FNO2S and a molecular weight of 263.29 g/mol. IUPAC name: 2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid. InChIKey: NKKMJXDCMFNXOS-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2S |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxylic acid |
| InChIKey | NKKMJXDCMFNXOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)SCC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)