CAS 461000-66-8 appears in our catalog under these names: Eact, 95%, Eact/ 98.62% (existing batch purity), Eact, Eact 98%, TMEM16A Activator, Eact 1PC X 10MG. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
3,4,5-trimethoxy-N-(2-methoxyethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CAS 461000-66-8) is a chemical compound with the molecular formula C22H24N2O5S and a molecular weight of 428.5 g/mol. IUPAC name: 3,4,5-trimethoxy-N-(2-methoxyethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide. InChIKey: ZUXNHFFVQWADJL-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O5S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-(2-methoxyethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | ZUXNHFFVQWADJL-UHFFFAOYSA-N |
| SMILES | COCCN(C1=NC(=CS1)C2=CC=CC=C2)C(=O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)