Products 461425-16-1

CAS 461425-16-1 is the registry number for Dimethylformamidium trifluoromethanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g.

Structural formula: {0} (CAS {1})

N,N-dimethylformamide;trifluoromethanesulfonic acid (CAS 461425-16-1) is a chemical compound with the molecular formula C4H8F3NO4S and a molecular weight of 223.17 g/mol. IUPAC name: N,N-dimethylformamide;trifluoromethanesulfonic acid. InChIKey: OTNRUIGCHNLSBT-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8F3NO4S
Molecular weight223.17 g/mol
IUPAC nameN,N-dimethylformamide;trifluoromethanesulfonic acid
InChIKeyOTNRUIGCHNLSBT-UHFFFAOYSA-N
SMILESCN(C)C=O.C(F)(F)(F)S(=O)(=O)O

Computed by PubChem (NCBI)