CAS 46167-49-1 is the registry number for 1-Mesitylguanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trimethylphenyl)guanidine (CAS 46167-49-1) is a chemical compound with the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)guanidine. InChIKey: GLKSRNURCQQYOR-UHFFFAOYSA-N.
| Molecular formula | C10H15N3 |
|---|---|
| Molecular weight | 177.25 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)guanidine |
| InChIKey | GLKSRNURCQQYOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=C(N)N)C |
Computed by PubChem (NCBI)