Products 462066-13-3
CAS 462066-13-3 is the registry number for 3-Chloro-5-cyclopropyl-8-thia-4,6-diazatricyclo(7.4.0.0,2,7)trideca-1(9),2,4,6-tetraene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2-cyclopropyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 462066-13-3) is a chemical compound with the molecular formula C13H13ClN2S and a molecular weight of 264.77 g/mol. IUPAC name: 4-chloro-2-cyclopropyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: IQOOKMNKIJCWAB-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2S |
|---|---|
| Molecular weight | 264.77 g/mol |
| IUPAC name | 4-chloro-2-cyclopropyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | IQOOKMNKIJCWAB-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(N=C3Cl)C4CC4 |
Computed by PubChem (NCBI)