CAS 462066-71-3 appears in our catalog under these names: 2,6–Diamino–9H–purine–8–thiol, 2,6-Diamino-9H-purine-8-thiol, 95%, 95%, 2,6-Diamino-9H-purine-8-thiol, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 1g, 100mg, 500mg, 5g.
2,6-diamino-7,9-dihydropurine-8-thione (CAS 462066-71-3) is a chemical compound with the molecular formula C5H6N6S and a molecular weight of 182.21 g/mol. IUPAC name: 2,6-diamino-7,9-dihydropurine-8-thione. InChIKey: VKXYEVRDQVTHAB-UHFFFAOYSA-N.
| Molecular formula | C5H6N6S |
|---|---|
| Molecular weight | 182.21 g/mol |
| IUPAC name | 2,6-diamino-7,9-dihydropurine-8-thione |
| InChIKey | VKXYEVRDQVTHAB-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(N=C1NC(=S)N2)N)N |
Computed by PubChem (NCBI)