Products 462637-49-6
CAS 462637-49-6 appears in our catalog under these names: 2-(4-Methanesulfonylphenyl)propanenitrile, 95%, 2-(4-Methanesulfonylphenyl)propanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(4-methylsulfonylphenyl)propanenitrile (CAS 462637-49-6) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)propanenitrile. InChIKey: MMUKSWLAKOHDIS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)propanenitrile |
| InChIKey | MMUKSWLAKOHDIS-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)