CAS 464913-93-7 is the registry number for (1R,2S)-2-Aminocyclopentanecarboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-aminocyclopentane-1-carboxamide (CAS 464913-93-7) is a chemical compound with the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclopentane-1-carboxamide. InChIKey: FUGFTUCRJJFPES-UHNVWZDZSA-N.
| Molecular formula | C6H12N2O |
|---|---|
| Molecular weight | 128.17 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclopentane-1-carboxamide |
| InChIKey | FUGFTUCRJJFPES-UHNVWZDZSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C(=O)N |
Computed by PubChem (NCBI)