CAS 465-73-6 appears in our catalog under these names: Isodrine, Isodrin, Isodrin 10 µg/mL in Cyclohexane, Isodrin 100 µg/mL in Isooctane, Isodrin 1000 µg/mL in n-Hexane. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 5g, 10ml, 1ml, 100G, 1x100mg, 1x10ml, 1x1ml.
(1S,2S,3R,6S,7R,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene (CAS 465-73-6) is a chemical compound with the molecular formula C12H8Cl6 and a molecular weight of 364.9 g/mol. IUPAC name: (1S,2S,3R,6S,7R,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene. InChIKey: QBYJBZPUGVGKQQ-DIFDVCDBSA-N.
| Molecular formula | C12H8Cl6 |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | (1S,2S,3R,6S,7R,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodeca-4,9-diene |
| InChIKey | QBYJBZPUGVGKQQ-DIFDVCDBSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]3[C@H]2[C@@]4(C(=C([C@]3(C4(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)