CAS 46506-88-1 appears in our catalog under these names: 3,5-Dinitro-2-hydroxybenzoic acid sodium, 95%, 3,5-Dinitrosalicylic acid sodium. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 50g.
Sodium 2-carboxy-4,6-dinitrophenolate (CAS 46506-88-1) is a chemical compound with the molecular formula C7H3N2NaO7 and a molecular weight of 250.10 g/mol. IUPAC name: sodium 2-carboxy-4,6-dinitrophenolate. InChIKey: VKSMGADJZIODFU-UHFFFAOYSA-M.
| Molecular formula | C7H3N2NaO7 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | sodium 2-carboxy-4,6-dinitrophenolate |
| InChIKey | VKSMGADJZIODFU-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[O-])[N+](=O)[O-])[N+](=O)[O-].[Na+] |
Computed by PubChem (NCBI)