CAS 4655-62-3 appears in our catalog under these names: 2,3-Dicyano-1,4-dihydroxy-5-nitronaphthalene, 95%, 2,3–Dicyano–1,4–dihydroxy–5–nitronaphthalene, 2,3-Dicyano-1,4-dihydroxy-5-nitronaphthalene, >98.0%(HPLC)(N), 2,3-Dicyano-1,4-dihydroxy-5-nitronaphthalene. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 5g, 1g, 200mg.
1,4-dihydroxy-5-nitronaphthalene-2,3-dicarbonitrile (CAS 4655-62-3) is a chemical compound with the molecular formula C12H5N3O4 and a molecular weight of 255.19 g/mol. IUPAC name: 1,4-dihydroxy-5-nitronaphthalene-2,3-dicarbonitrile. InChIKey: FFSZGCAJTTUCCU-UHFFFAOYSA-N.
| Molecular formula | C12H5N3O4 |
|---|---|
| Molecular weight | 255.19 g/mol |
| IUPAC name | 1,4-dihydroxy-5-nitronaphthalene-2,3-dicarbonitrile |
| InChIKey | FFSZGCAJTTUCCU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=C(C(=C2O)C#N)C#N)O |
Computed by PubChem (NCBI)