CAS 4656-39-7 is the registry number for Lithium Propyl Phosphate. Offered by: TRC. Available pack sizes: 1g.
Dilithium;propyl phosphate (CAS 4656-39-7) is a chemical compound with the molecular formula C3H7Li2O4P and a molecular weight of 152.0 g/mol. IUPAC name: dilithium;propyl phosphate. InChIKey: PXHZVPMXWNTBKG-UHFFFAOYSA-L.
| Molecular formula | C3H7Li2O4P |
|---|---|
| Molecular weight | 152.0 g/mol |
| IUPAC name | dilithium;propyl phosphate |
| InChIKey | PXHZVPMXWNTBKG-UHFFFAOYSA-L |
| SMILES | [Li+].[Li+].CCCOP(=O)([O-])[O-] |
Computed by PubChem (NCBI)