CAS 466-37-5 appears in our catalog under these names: Benzopinacolone/ 98+%, 2,2,2-Triphenylacetophenone, 98%, 2,2,2-Triphenylacetophenone, 2,2,2–Triphenylacetophenone, 2,2,2-Triphenylacetophenone, >99.0%(GC). Offered by: Chemat, Combi-blocks, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 50g, 5 g, 10 g.
1,2,2,2-tetraphenylethanone (CAS 466-37-5) is a chemical compound with the molecular formula C26H20O and a molecular weight of 348.4 g/mol. IUPAC name: 1,2,2,2-tetraphenylethanone. InChIKey: CFBBKHROQRFCNZ-UHFFFAOYSA-N.
| Molecular formula | C26H20O |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 1,2,2,2-tetraphenylethanone |
| InChIKey | CFBBKHROQRFCNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)