Products 4668-81-9
CAS 4668-81-9 is the registry number for trans-rel-(3R,7R)-Octahydro-5H-inden-5-one. Offered by: TRC. Available pack sizes: 250mg.
(3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydroinden-5-one (CAS 4668-81-9) is a chemical compound with the molecular formula C9H14O and a molecular weight of 138.21 g/mol. IUPAC name: (3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydroinden-5-one. InChIKey: FSUBUYXKSKDDHL-HTQZYQBOSA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 138.21 g/mol |
| IUPAC name | (3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydroinden-5-one |
| InChIKey | FSUBUYXKSKDDHL-HTQZYQBOSA-N |
| SMILES | C1C[C@@H]2CCC(=O)C[C@H]2C1 |
Computed by PubChem (NCBI)