CAS 46696-24-6 is the registry number for 2,5-Dicyanoterephthalic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 10mg, 1g.
2,5-dicyanoterephthalic acid (CAS 46696-24-6) is a chemical compound with the molecular formula C10H4N2O4 and a molecular weight of 216.15 g/mol. IUPAC name: 2,5-dicyanoterephthalic acid. InChIKey: XBBSUDFJLPWTPE-UHFFFAOYSA-N.
| Molecular formula | C10H4N2O4 |
|---|---|
| Molecular weight | 216.15 g/mol |
| IUPAC name | 2,5-dicyanoterephthalic acid |
| InChIKey | XBBSUDFJLPWTPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)C#N)C(=O)O)C#N |
Computed by PubChem (NCBI)