Products 46696-24-6

CAS 46696-24-6 is the registry number for 2,5-Dicyanoterephthalic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 10mg, 1g.

Structural formula: {0} (CAS {1})

2,5-dicyanoterephthalic acid (CAS 46696-24-6) is a chemical compound with the molecular formula C10H4N2O4 and a molecular weight of 216.15 g/mol. IUPAC name: 2,5-dicyanoterephthalic acid. InChIKey: XBBSUDFJLPWTPE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4N2O4
Molecular weight216.15 g/mol
IUPAC name2,5-dicyanoterephthalic acid
InChIKeyXBBSUDFJLPWTPE-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1C(=O)O)C#N)C(=O)O)C#N

Computed by PubChem (NCBI)