CAS 46731-94-6 appears in our catalog under these names: 4-(3,4-Dimethylphenoxy)aniline, 95%, 4-(3,4-Dimethylphenoxy)aniline 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-(3,4-dimethylphenoxy)aniline (CAS 46731-94-6) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 4-(3,4-dimethylphenoxy)aniline. InChIKey: UZSYASHQOZQTII-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 4-(3,4-dimethylphenoxy)aniline |
| InChIKey | UZSYASHQOZQTII-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)