CAS 467458-02-2 appears in our catalog under these names: Idalopirdine Hydrochloride/ 99.97% (existing batch purity), Lu AE58054 Hydrochloride, Idalopirdine HCl 99%, Lu AE58054 Hydrochloride, 99%, 99%, Idalopirdine (hydrochloride), 99.64%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride (CAS 467458-02-2) is a chemical compound with the molecular formula C20H20ClF5N2O and a molecular weight of 434.8 g/mol. IUPAC name: 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride. InChIKey: KXOQNPANAFXKTN-UHFFFAOYSA-N.
| Molecular formula | C20H20ClF5N2O |
|---|---|
| Molecular weight | 434.8 g/mol |
| IUPAC name | 2-(6-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride |
| InChIKey | KXOQNPANAFXKTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(C(F)F)(F)F)CNCCC2=CNC3=C2C=CC(=C3)F.Cl |
Computed by PubChem (NCBI)