Products 468-07-5
CAS 468-07-5 appears in our catalog under these names: Phenomorphan (1.0 mg/mL in Methanol), Phenomorphan. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
(1R,9R,10R)-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (CAS 468-07-5) is a chemical compound with the molecular formula C24H29NO and a molecular weight of 347.5 g/mol. IUPAC name: (1R,9R,10R)-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol. InChIKey: CFBQYWXPZVQQTN-QPTUXGOLSA-N.
| Molecular formula | C24H29NO |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | (1R,9R,10R)-17-(2-phenylethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| InChIKey | CFBQYWXPZVQQTN-QPTUXGOLSA-N |
| SMILES | C1CC[C@@]23CCN([C@@H]([C@@H]2C1)CC4=C3C=C(C=C4)O)CCC5=CC=CC=C5 |
Computed by PubChem (NCBI)