Products 4682-43-3
CAS 4682-43-3 is the registry number for 2'-Deoxy-3',5'-CDP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (CAS 4682-43-3) is a chemical compound with the molecular formula C9H15N3O10P2 and a molecular weight of 387.18 g/mol. IUPAC name: [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate. InChIKey: PIILJQRMNSOCFD-SHYZEUOFSA-N.
| Molecular formula | C9H15N3O10P2 |
|---|---|
| Molecular weight | 387.18 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| InChIKey | PIILJQRMNSOCFD-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=O)(O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)