CAS 4685-10-3 appears in our catalog under these names: 1-Methyl-3-(methoxycarbonyl)pyridinium iodide, ≥95%, ≥95%, 3-(Methoxycarbonyl)-1-methylpyridin-1-ium iodide, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
Methyl 1-methylpyridin-1-ium-3-carboxylate iodide (CAS 4685-10-3) is a chemical compound with the molecular formula C8H10INO2 and a molecular weight of 279.07 g/mol. IUPAC name: methyl 1-methylpyridin-1-ium-3-carboxylate iodide. InChIKey: GAVGHZAEUQBEFK-UHFFFAOYSA-M.
| Molecular formula | C8H10INO2 |
|---|---|
| Molecular weight | 279.07 g/mol |
| IUPAC name | methyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| InChIKey | GAVGHZAEUQBEFK-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=CC(=C1)C(=O)OC.[I-] |
Computed by PubChem (NCBI)