CAS 468717-73-9 appears in our catalog under these names: 3–formyl–1–tosyl–1H–indole–5–carbonitrile, 3-Formyl-1-tosyl-1H-indole-5-carbonitrile, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg, 1g.
3-formyl-1-(4-methylphenyl)sulfonylindole-5-carbonitrile (CAS 468717-73-9) is a chemical compound with the molecular formula C17H12N2O3S and a molecular weight of 324.4 g/mol. IUPAC name: 3-formyl-1-(4-methylphenyl)sulfonylindole-5-carbonitrile. InChIKey: BFYKSJLAZUDDKP-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O3S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-formyl-1-(4-methylphenyl)sulfonylindole-5-carbonitrile |
| InChIKey | BFYKSJLAZUDDKP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C=CC(=C3)C#N)C=O |
Computed by PubChem (NCBI)