CAS 469-32-9 appears in our catalog under these names: Hamamelitannin, Hamamelitannin, >95% (HPLC), Hamamelitannin/ 98.97% (existing batch purity), HAMAMELITANNIN, >=98.0% HPLC, Hamamelofuranose2,5-digallate. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 0,5mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
[(2R,3R,4R)-4-formyl-2,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyl)oxypentyl] 3,4,5-trihydroxybenzoate (CAS 469-32-9) is a chemical compound with the molecular formula C20H20O14 and a molecular weight of 484.4 g/mol. IUPAC name: [(2R,3R,4R)-4-formyl-2,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyl)oxypentyl] 3,4,5-trihydroxybenzoate. InChIKey: STINYPFJROKCKD-WIBUTAKZSA-N.
| Molecular formula | C20H20O14 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | [(2R,3R,4R)-4-formyl-2,3,4-trihydroxy-5-(3,4,5-trihydroxybenzoyl)oxypentyl] 3,4,5-trihydroxybenzoate |
| InChIKey | STINYPFJROKCKD-WIBUTAKZSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@H]([C@H]([C@](COC(=O)C2=CC(=C(C(=C2)O)O)O)(C=O)O)O)O |
Computed by PubChem (NCBI)