CAS 469-49-8 appears in our catalog under these names: Epigriseofulvin, Epigriseofulvin, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
(2R,5'R)-7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (CAS 469-49-8) is a chemical compound with the molecular formula C17H17ClO6 and a molecular weight of 352.8 g/mol. IUPAC name: (2R,5'R)-7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione. InChIKey: DDUHZTYCFQRHIY-CQLKUDPESA-N.
| Molecular formula | C17H17ClO6 |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | (2R,5'R)-7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| InChIKey | DDUHZTYCFQRHIY-CQLKUDPESA-N |
| SMILES | C[C@@H]1CC(=O)C=C([C@@]12C(=O)C3=C(O2)C(=C(C=C3OC)OC)Cl)OC |
Computed by PubChem (NCBI)