CAS 4695-14-1 is the registry number for N,2,2-Triphenylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
N,2,2-triphenylacetamide (CAS 4695-14-1) is a chemical compound with the molecular formula C20H17NO and a molecular weight of 287.4 g/mol. IUPAC name: N,2,2-triphenylacetamide. InChIKey: IZXIEFMHCBDPSE-UHFFFAOYSA-N.
| Molecular formula | C20H17NO |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | N,2,2-triphenylacetamide |
| InChIKey | IZXIEFMHCBDPSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)