CAS 4703-36-0 is the registry number for Tosyl-S-Benzyl-L-cysteine. Offered by: Creative Peptides. Available pack sizes: on request.
3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid (CAS 4703-36-0) is a chemical compound with the molecular formula C17H19NO4S2 and a molecular weight of 365.5 g/mol. IUPAC name: 3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid. InChIKey: MKQPPJXESXECOF-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S2 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | 3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| InChIKey | MKQPPJXESXECOF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CSCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)