Products 4703-36-0

CAS 4703-36-0 is the registry number for Tosyl-S-Benzyl-L-cysteine. Offered by: Creative Peptides. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid (CAS 4703-36-0) is a chemical compound with the molecular formula C17H19NO4S2 and a molecular weight of 365.5 g/mol. IUPAC name: 3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid. InChIKey: MKQPPJXESXECOF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4S2
Molecular weight365.5 g/mol
IUPAC name3-benzylsulfanyl-2-[(4-methylphenyl)sulfonylamino]propanoic acid
InChIKeyMKQPPJXESXECOF-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)NC(CSCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)