Products 470463-44-6

CAS 470463-44-6 is the registry number for 2-Chloro-4-trimethylsilanylethynyl-nicotinic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-4-(2-trimethylsilylethynyl)pyridine-3-carboxylate (CAS 470463-44-6) is a chemical compound with the molecular formula C12H14ClNO2Si and a molecular weight of 267.78 g/mol. IUPAC name: methyl 2-chloro-4-(2-trimethylsilylethynyl)pyridine-3-carboxylate. InChIKey: YXAFNLLWRMATGC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO2Si
Molecular weight267.78 g/mol
IUPAC namemethyl 2-chloro-4-(2-trimethylsilylethynyl)pyridine-3-carboxylate
InChIKeyYXAFNLLWRMATGC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CN=C1Cl)C#C[Si](C)(C)C

Computed by PubChem (NCBI)