CAS 470466-07-0 appears in our catalog under these names: 3,3'–Disulfo–(1,1'–biphenyl)–4,4'–dicarboxylic acid, 3,3'-Disulfo-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 95%, 3,3'-Disulfo-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-(4-carboxy-3-sulfophenyl)-2-sulfobenzoic acid (CAS 470466-07-0) is a chemical compound with the molecular formula C14H10O10S2 and a molecular weight of 402.4 g/mol. IUPAC name: 4-(4-carboxy-3-sulfophenyl)-2-sulfobenzoic acid. InChIKey: FBPGYBAYUZQKSE-UHFFFAOYSA-N.
| Molecular formula | C14H10O10S2 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 4-(4-carboxy-3-sulfophenyl)-2-sulfobenzoic acid |
| InChIKey | FBPGYBAYUZQKSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)S(=O)(=O)O)S(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)