CAS 470472-16-3 is the registry number for 1-[2-Nitro-4-(trifluoromethyl)phenyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine;hydrochloride (CAS 470472-16-3) is a chemical compound with the molecular formula C11H13ClF3N3O2 and a molecular weight of 311.69 g/mol. IUPAC name: 1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine;hydrochloride. InChIKey: HMCNERKLDYVVHH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N3O2 |
|---|---|
| Molecular weight | 311.69 g/mol |
| IUPAC name | 1-[2-nitro-4-(trifluoromethyl)phenyl]piperazine;hydrochloride |
| InChIKey | HMCNERKLDYVVHH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)