Products 4707-51-1

CAS 4707-51-1 is the registry number for 2,6-Dihydroxy-3-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,6-dihydroxy-3-methylbenzoic acid (CAS 4707-51-1) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 2,6-dihydroxy-3-methylbenzoic acid. InChIKey: VPOJUHYTIGDTIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O4
Molecular weight168.15 g/mol
IUPAC name2,6-dihydroxy-3-methylbenzoic acid
InChIKeyVPOJUHYTIGDTIZ-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)O)C(=O)O)O

Computed by PubChem (NCBI)