CAS 4712-51-0 appears in our catalog under these names: Bis(trimethylsilylmethyl) sulfide, 95%, Bis(trimethylsilylmethyl) Sulfide, Bis(trimethylsilylmethyl) Sulfide, >95.0%(GC), BIS(TRIMETHYLSILYLMETHYL) SULFIDE, >=98&. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 1ml, 5ML.
Trimethyl(trimethylsilylmethylsulfanylmethyl)silane (CAS 4712-51-0) is a chemical compound with the molecular formula C8H22SSi2 and a molecular weight of 206.50 g/mol. IUPAC name: trimethyl(trimethylsilylmethylsulfanylmethyl)silane. InChIKey: GISUCMFTNKRCPF-UHFFFAOYSA-N.
| Molecular formula | C8H22SSi2 |
|---|---|
| Molecular weight | 206.50 g/mol |
| IUPAC name | trimethyl(trimethylsilylmethylsulfanylmethyl)silane |
| InChIKey | GISUCMFTNKRCPF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CSC[Si](C)(C)C |
Computed by PubChem (NCBI)