Products 47142-51-8
CAS 47142-51-8 appears in our catalog under these names: Phentolamine Analogue 1, Phentolamine Analogue 1, LUN42518 HCl 47142-51-8(free base)/ 99.85% (existing batch purity). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 20mg.
4-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol (CAS 47142-51-8) is a chemical compound with the molecular formula C17H19N3O and a molecular weight of 281.35 g/mol. IUPAC name: 4-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol. InChIKey: LBXLJKWLYGGOTD-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | 4-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol |
| InChIKey | LBXLJKWLYGGOTD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)