CAS 47182-95-6 is the registry number for Diphenyl(4-vinylphenyl)phosphine oxide, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.
1-diphenylphosphoryl-4-ethenylbenzene (CAS 47182-95-6) is a chemical compound with the molecular formula C20H17OP and a molecular weight of 304.3 g/mol. IUPAC name: 1-diphenylphosphoryl-4-ethenylbenzene. InChIKey: SJWKDSPENQGMEB-UHFFFAOYSA-N.
| Molecular formula | C20H17OP |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 1-diphenylphosphoryl-4-ethenylbenzene |
| InChIKey | SJWKDSPENQGMEB-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)