Products 47182-95-6

CAS 47182-95-6 is the registry number for Diphenyl(4-vinylphenyl)phosphine oxide, 97% mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-diphenylphosphoryl-4-ethenylbenzene (CAS 47182-95-6) is a chemical compound with the molecular formula C20H17OP and a molecular weight of 304.3 g/mol. IUPAC name: 1-diphenylphosphoryl-4-ethenylbenzene. InChIKey: SJWKDSPENQGMEB-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17OP
Molecular weight304.3 g/mol
IUPAC name1-diphenylphosphoryl-4-ethenylbenzene
InChIKeySJWKDSPENQGMEB-UHFFFAOYSA-N
SMILESC=CC1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)