CAS 4719-75-9 appears in our catalog under these names: Fosfestrol Tetrasodium Salt, >95% (HPLC), Fosfestrol sodium. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 500mg, 250mg, 1000mg, 5000mg.
Sodium [4-[(3R,4S)-4-(4-phosphonooxyphenyl)hexan-3-yl]phenyl] hydrogen phosphate (CAS 4719-75-9) is a chemical compound with the molecular formula C18H23NaO8P2 and a molecular weight of 452.3 g/mol. IUPAC name: sodium [4-[(3R,4S)-4-(4-phosphonooxyphenyl)hexan-3-yl]phenyl] hydrogen phosphate. InChIKey: QVTPDQKKWFAKFO-GNXQHMNLSA-M.
| Molecular formula | C18H23NaO8P2 |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | sodium [4-[(3R,4S)-4-(4-phosphonooxyphenyl)hexan-3-yl]phenyl] hydrogen phosphate |
| InChIKey | QVTPDQKKWFAKFO-GNXQHMNLSA-M |
| SMILES | CC[C@H](C1=CC=C(C=C1)OP(=O)(O)O)[C@@H](CC)C2=CC=C(C=C2)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)