CAS 471908-58-4 is the registry number for Fmoc-Ala-Ala-Gly-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid (CAS 471908-58-4) is a chemical compound with the molecular formula C23H25N3O6 and a molecular weight of 439.5 g/mol. IUPAC name: 2-[[(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid. InChIKey: GZEHCNPNGUPXLF-KBPBESRZSA-N.
| Molecular formula | C23H25N3O6 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 2-[[(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid |
| InChIKey | GZEHCNPNGUPXLF-KBPBESRZSA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@H](C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)