CAS 472-62-8 is the registry number for all-trans-Isocryptoxanthin. Offered by: TRC. Available pack sizes: 25mg.
4-hydroxy-all-trans-beta-carotene is a beta-carotene carrying one additional hydroxy substituent at position 4. It is functionally related to a beta-carotene.
Source: ChEBI
| Molecular formula | C40H56O |
|---|---|
| Molecular weight | 552.9 g/mol |
| IUPAC name | 2,4,4-trimethyl-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-ol |
| InChIKey | JCRCKXUPYKELBT-QQGJMDNJSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C(CCC2(C)C)O)C)/C)/C |
Computed by PubChem (NCBI)