CAS 47250-53-3 appears in our catalog under these names: 2,2-Bis(3-aminophenyl)hexafluoropropane, 2,2-Bis(3-aminophenyl)hexafluoropropane, >98.0%(GC)(T). Offered by: Biosynth, TCI. Available pack sizes: 10g, 5g.
3-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline (CAS 47250-53-3) is a chemical compound with the molecular formula C15H12F6N2 and a molecular weight of 334.26 g/mol. IUPAC name: 3-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline. InChIKey: UVUCUHVQYAPMEU-UHFFFAOYSA-N.
| Molecular formula | C15H12F6N2 |
|---|---|
| Molecular weight | 334.26 g/mol |
| IUPAC name | 3-[2-(3-aminophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]aniline |
| InChIKey | UVUCUHVQYAPMEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C2=CC(=CC=C2)N)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)