CAS 473-41-6 appears in our catalog under these names: Tolbutamide Sodium, Tolbutamide Sodium, Tolbutamide (sodium). Offered by: Chemat Brand, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: on request, 1g, 5g, 25mg, 50mg, 100mg, 2g, 10g.
Sodium butylcarbamoyl-(4-methylphenyl)sulfonylazanide (CAS 473-41-6) is a chemical compound with the molecular formula C12H17N2NaO3S and a molecular weight of 292.33 g/mol. IUPAC name: sodium butylcarbamoyl-(4-methylphenyl)sulfonylazanide. InChIKey: QKHDBRQBSNZFAK-UHFFFAOYSA-M.
| Molecular formula | C12H17N2NaO3S |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | sodium butylcarbamoyl-(4-methylphenyl)sulfonylazanide |
| InChIKey | QKHDBRQBSNZFAK-UHFFFAOYSA-M |
| SMILES | CCCCNC(=O)[N-]S(=O)(=O)C1=CC=C(C=C1)C.[Na+] |
Computed by PubChem (NCBI)