CAS 4732-72-3 appears in our catalog under these names: Benzofuran-2,3-dione, 95%, Benzofuran-2,3-dione, Benzofuran-2,3-dione, >97%, >97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-benzofuran-2,3-dione (CAS 4732-72-3) is a chemical compound with the molecular formula C8H4O3 and a molecular weight of 148.11 g/mol. IUPAC name: 1-benzofuran-2,3-dione. InChIKey: UUISWLJHAJBRAA-UHFFFAOYSA-N.
| Molecular formula | C8H4O3 |
|---|---|
| Molecular weight | 148.11 g/mol |
| IUPAC name | 1-benzofuran-2,3-dione |
| InChIKey | UUISWLJHAJBRAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)O2 |
Computed by PubChem (NCBI)