CAS 474-08-8 is the registry number for Demissidine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 1 mg, 50 mg, 10 mg.
Demissidine is an alkaloid, a steroid and an organic heteropolycyclic compound.
Source: ChEBI
| Molecular formula | C27H45NO |
|---|---|
| Molecular weight | 399.7 g/mol |
| IUPAC name | (1S,2R,5S,7S,10S,11S,14S,15R,16S,17R,20S,23S)-10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracosan-7-ol |
| InChIKey | JALVTHFTYRPDMB-HRRTYWNUSA-N |
| SMILES | C[C@H]1CC[C@@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O)C)C)C |
Computed by PubChem (NCBI)