Products 474084-56-5
CAS 474084-56-5 is the registry number for CSV0C018875 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine;hydrochloride (CAS 474084-56-5) is a chemical compound with the molecular formula C18H18Cl2N2O and a molecular weight of 349.3 g/mol. IUPAC name: 6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine;hydrochloride. InChIKey: IJKBUMLHWSYUGI-UHFFFAOYSA-N.
| Molecular formula | C18H18Cl2N2O |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 6-chloro-N-(4-ethoxyphenyl)-2-methylquinolin-4-amine;hydrochloride |
| InChIKey | IJKBUMLHWSYUGI-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=C3C=C(C=CC3=NC(=C2)C)Cl.Cl |
Computed by PubChem (NCBI)