Products 474711-91-6

CAS 474711-91-6 is the registry number for N-Phenylpiperazine-1-carboxamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

N-phenylpiperazine-1-carboxamide;hydrochloride (CAS 474711-91-6) is a chemical compound with the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. IUPAC name: N-phenylpiperazine-1-carboxamide;hydrochloride. InChIKey: UZABGZZRNRUJIS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClN3O
Molecular weight241.72 g/mol
IUPAC nameN-phenylpiperazine-1-carboxamide;hydrochloride
InChIKeyUZABGZZRNRUJIS-UHFFFAOYSA-N
SMILESC1CN(CCN1)C(=O)NC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)