Products 474892-43-8
CAS 474892-43-8 is the registry number for 2-(2,6-Dimethylmorpholino)-2-oxoethyl 2,6-dichlorobenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate (CAS 474892-43-8) is a chemical compound with the molecular formula C15H17Cl2NO4 and a molecular weight of 346.2 g/mol. IUPAC name: [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate. InChIKey: UGTPXQXEBKMHJY-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO4 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2,6-dichlorobenzoate |
| InChIKey | UGTPXQXEBKMHJY-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C(=O)COC(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)