CAS 474923-51-8 appears in our catalog under these names: 9-Octadecenoic acid (9Z)-, 1,1'-[(1R)-1-[[[hydroxy(2-hydroxyethoxy)phosphinyl]oxy]methyl]-1,2-ethanediyl] ester, sodium salt (1:1), 95%, 18:1 PTD ETHYLENE GLYCOL, 18:1 Ptd Ethylene glycol (sodium). Offered by: Chemat Brand, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 25MG, Get quote.
Sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 2-hydroxyethyl phosphate (CAS 474923-51-8) is a chemical compound with the molecular formula C41H76NaO9P and a molecular weight of 767.0 g/mol. IUPAC name: sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 2-hydroxyethyl phosphate. InChIKey: NQNFIFRFZRXHMZ-YSHLVRMWSA-M.
| Molecular formula | C41H76NaO9P |
|---|---|
| Molecular weight | 767.0 g/mol |
| IUPAC name | sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 2-hydroxyethyl phosphate |
| InChIKey | NQNFIFRFZRXHMZ-YSHLVRMWSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCCO)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Na+] |
Computed by PubChem (NCBI)