CAS 474955-53-8 appears in our catalog under these names: Trt-gln(trt)-oh dea, 95%, (S)-5-Oxo-2,5-bis(tritylamino)pentanoic acid, 95+%, Trt-Gln(Trt)-OH Dea, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g.
N-ethylethanamine;(2S)-5-oxo-2,5-bis(tritylamino)pentanoic acid (CAS 474955-53-8) is a chemical compound with the molecular formula C47H49N3O3 and a molecular weight of 703.9 g/mol. IUPAC name: N-ethylethanamine;(2S)-5-oxo-2,5-bis(tritylamino)pentanoic acid. InChIKey: PHBRODKUSRNHSN-UFUJWDBKSA-N.
| Molecular formula | C47H49N3O3 |
|---|---|
| Molecular weight | 703.9 g/mol |
| IUPAC name | N-ethylethanamine;(2S)-5-oxo-2,5-bis(tritylamino)pentanoic acid |
| InChIKey | PHBRODKUSRNHSN-UFUJWDBKSA-N |
| SMILES | CCNCC.C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@@H](CCC(=O)NC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C(=O)O |
Computed by PubChem (NCBI)