Products 475150-68-6

CAS 475150-68-6 is the registry number for 4-Amino-5-fluoro-2-hydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-amino-5-fluoro-2-hydroxybenzoic acid (CAS 475150-68-6) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 4-amino-5-fluoro-2-hydroxybenzoic acid. InChIKey: VEAKICTWBOTIQF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO3
Molecular weight171.13 g/mol
IUPAC name4-amino-5-fluoro-2-hydroxybenzoic acid
InChIKeyVEAKICTWBOTIQF-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)N)O)C(=O)O

Computed by PubChem (NCBI)