CAS 475275-01-5 is the registry number for cis-Chlordane-13C8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R,3S,4R,6R,7R)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene (CAS 475275-01-5) is a chemical compound with the molecular formula C10H6Cl8 and a molecular weight of 417.7 g/mol. IUPAC name: (1S,2R,3S,4R,6R,7R)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene. InChIKey: BIWJNBZANLAXMG-PFTJODLDSA-N.
| Molecular formula | C10H6Cl8 |
|---|---|
| Molecular weight | 417.7 g/mol |
| IUPAC name | (1S,2R,3S,4R,6R,7R)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene |
| InChIKey | BIWJNBZANLAXMG-PFTJODLDSA-N |
| SMILES | [13CH2]1[13C@@H]2[13C@H]([13C@@H]([13C@@H]1Cl)Cl)[13C@@]3(C(=[13C]([13C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)