CAS 475285-30-4 is the registry number for Rel-(1R,2S,5R)-2-isopropyl-5-methylcyclohexane-1-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonitrile (CAS 475285-30-4) is a chemical compound with the molecular formula C11H19N and a molecular weight of 165.27 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonitrile. InChIKey: AWVUYKHSNNYPOX-VWYCJHECSA-N.
| Molecular formula | C11H19N |
|---|---|
| Molecular weight | 165.27 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonitrile |
| InChIKey | AWVUYKHSNNYPOX-VWYCJHECSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C#N)C(C)C |
Computed by PubChem (NCBI)