CAS 475295-86-4 appears in our catalog under these names: 4-Chlorophenol 13C6, 4-Chlorophenol-13C6, >95% (HPLC), 4-Chlorophenol 13C6 100 µg/mL in Methanol. Offered by: Dr. Ehrenstorfer, TRC. Available pack sizes: 10mg, 2,5mg, 1ml.
4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 475295-86-4) is a chemical compound with the molecular formula C6H5ClO and a molecular weight of 134.51 g/mol. IUPAC name: 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: WXNZTHHGJRFXKQ-IDEBNGHGSA-N.
| Molecular formula | C6H5ClO |
|---|---|
| Molecular weight | 134.51 g/mol |
| IUPAC name | 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | WXNZTHHGJRFXKQ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1O)Cl |
Computed by PubChem (NCBI)