CAS 4753-03-1 appears in our catalog under these names: 2'-Deoxy-2'-iodouridine, 95%, 2’-Deoxy-2’-iodouridine, 2’-Iodo-2’-deoxyuridine. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 1g, 250mg, Get quote.
1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]pyrimidine-2,4-dione (CAS 4753-03-1) is a chemical compound with the molecular formula C9H11IN2O5 and a molecular weight of 354.10 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]pyrimidine-2,4-dione. InChIKey: KVQOKCWRUQHGQR-XVFCMESISA-N.
| Molecular formula | C9H11IN2O5 |
|---|---|
| Molecular weight | 354.10 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-iodooxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | KVQOKCWRUQHGQR-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)I |
Computed by PubChem (NCBI)