CAS 475488-23-4 appears in our catalog under these names: NVP-ADW742, 99%, NVP–ADW742, NVP-ADW742/ 99.79% (existing batch purity), NVP ADW 742, 5-[3-(Phenylmethoxy)Phenyl]-7-[Trans-3-(1-Pyrrolidinylmethyl)Cyclobutyl]-7H-Pyrrolo[2,3-d]Pyrimidin-4-Amine, 98.70% ,, 98.70% ,. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 10mg, 200mg, 5mg, 50mg, 1mg, 2mg.
5-(3-phenylmethoxyphenyl)-7-[3-(pyrrolidin-1-ylmethyl)cyclobutyl]pyrrolo[2,3-d]pyrimidin-4-amine (CAS 475488-23-4) is a chemical compound with the molecular formula C28H31N5O and a molecular weight of 453.6 g/mol. IUPAC name: 5-(3-phenylmethoxyphenyl)-7-[3-(pyrrolidin-1-ylmethyl)cyclobutyl]pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: LSFLAQVDISHMNB-UHFFFAOYSA-N.
| Molecular formula | C28H31N5O |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | 5-(3-phenylmethoxyphenyl)-7-[3-(pyrrolidin-1-ylmethyl)cyclobutyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | LSFLAQVDISHMNB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2CC(C2)N3C=C(C4=C(N=CN=C43)N)C5=CC(=CC=C5)OCC6=CC=CC=C6 |
Computed by PubChem (NCBI)